ChemNet > CAS > 909-84-2 6,7-bis(benzyloxy)cumarine
909-84-2 6,7-bis(benzyloxy)cumarine
Naam product |
6,7-bis(benzyloxy)cumarine |
Synoniemen |
Esculetin-dibenzyletether; 6,7-bis(benzyloxy)-2H-chromen-2-on |
Engelse naam |
6,7-Bis(benzyloxy)coumarin; Esculetin dibenzyl ether; 6,7-bis(benzyloxy)-2H-chromen-2-one |
MF |
C23H18O4 |
Molecuulgewicht |
358.3866 |
InChI |
InChI=1/C23H18O4/c24-23-12-11-19-13-21(25-15-17-7-3-1-4-8-17)22(14-20(19)27-23)26-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
CAS-nummer |
909-84-2 |
EINECS |
213-003-9 |
Moleculaire Structuur |
|
Dichtheid |
1.25g/cm3 |
Kookpunt |
560.2°C at 760 mmHg |
Brekingsindex |
1.631 |
Vlampunt |
246°C |
Dampdruk |
1.4E-12mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|